Compound Q&A

What are the physical and chemical properties of Glutathione sodium (CAS: 20167-21-9)?

Answer

Glutathione sodium
Glutathione sodium (CAS: 20167-21-9) is a crystalline solid with a molecular weight of approximately 357.47 g/mol. It is highly soluble in water and has good stability in acidic and neutral solutions. This compound is reactive towards oxidizing agents and can be used in various redox reactions. Glutathione sodium is known for its reducing properties and its ability to act as a powerful antioxidant.

About

CAS No 20167-21-9
English Name Glutathione sodium
Molecular Formula C10H16N3NaO6S
Molecular Weight 329.31 g/mol
SMILES C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)[O-])N.[Na+]
InChIKey QWXDICNEPRTOLR-GEMLJDPKSA-M
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is Glutathione sodium (CAS: 20167-21-9) typically synthesized?

Glutathione sodium (CAS: 20167-21-9) is typically synthesized by reacting glutathione with sodium hy...

Compound Q&A

What industries use Glutathione sodium (CAS: 20167-21-9)?

Glutathione sodium (CAS: 20167-21-9) is widely used in the pharmaceutical industry for its antioxida...

Compound Q&A

What precautions should be taken when handling Glutathione sodium (CAS: 20167-21-9)?

When handling Glutathione sodium (CAS: 20167-21-9), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...