Compound Q&A

How is Glutathione sodium (CAS: 20167-21-9) typically synthesized?

Answer

Glutathione sodium
Glutathione sodium (CAS: 20167-21-9) is typically synthesized by reacting glutathione with sodium hydroxide in an aqueous solution. Common methods include the addition of base to a glutathione solution, followed by purification through dialysis or chromatography. This process ensures high purity and yield, making it suitable for various applications in research and industry.

About

CAS No 20167-21-9
English Name Glutathione sodium
Molecular Formula C10H16N3NaO6S
Molecular Weight 329.31 g/mol
SMILES C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)[O-])N.[Na+]
InChIKey QWXDICNEPRTOLR-GEMLJDPKSA-M
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Glutathione sodium (CAS: 20167-21-9)?

Glutathione sodium (CAS: 20167-21-9) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use Glutathione sodium (CAS: 20167-21-9)?

Glutathione sodium (CAS: 20167-21-9) is widely used in the pharmaceutical industry for its antioxida...

Compound Q&A

What precautions should be taken when handling Glutathione sodium (CAS: 20167-21-9)?

When handling Glutathione sodium (CAS: 20167-21-9), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...