Compound Q&A

What industries use Glutathione sodium (CAS: 20167-21-9)?

Answer

Glutathione sodium
Glutathione sodium (CAS: 20167-21-9) is widely used in the pharmaceutical industry for its antioxidant and detoxifying properties. It is also applied in the polymer industry to improve the stability of polymers. In the sensor industry, it serves as a reducing agent in biosensors. Additionally, it is utilized in the semiconductor industry for cleaning and etching processes due to its reductive properties.

About

CAS No 20167-21-9
English Name Glutathione sodium
Molecular Formula C10H16N3NaO6S
Molecular Weight 329.31 g/mol
SMILES C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)[O-])N.[Na+]
InChIKey QWXDICNEPRTOLR-GEMLJDPKSA-M
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Glutathione sodium (CAS: 20167-21-9)?

Glutathione sodium (CAS: 20167-21-9) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is Glutathione sodium (CAS: 20167-21-9) typically synthesized?

Glutathione sodium (CAS: 20167-21-9) is typically synthesized by reacting glutathione with sodium hy...

Compound Q&A

What precautions should be taken when handling Glutathione sodium (CAS: 20167-21-9)?

When handling Glutathione sodium (CAS: 20167-21-9), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...