Compound Q&A

What precautions should be taken when handling 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

Answer

2-Hydrazinobenzenesulfonamide
When handling 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be used in a well-ventilated area or a fume hood to avoid inhalation. In case of a spill, immediately clean up with appropriate absorbents and follow the safety data sheet (SDS) guidelines for disposal and emergency response.

About

CAS No 90824-33-2
English Name 2-Hydrazinobenzenesulfonamide
Molecular Formula C6H9N3O2S
Molecular Weight 187.22 g/mol
SMILES C1=CC=C(C(=C1)NN)S(=O)(=O)N
InChIKey CTEZEDIMFASQNI-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) is a crystalline compound with a molecular weight of...

Compound Q&A

How is 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) typically synthesized?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) can be synthesized through a multi-step process invo...

Compound Q&A

What industries use 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) finds applications in various industries. It is used...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...