Compound Q&A

What industries use 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

Answer

2-Hydrazinobenzenesulfonamide
2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) finds applications in various industries. It is used in the pharmaceutical sector for the synthesis of certain drugs due to its hydrazine group, which can participate in medicinal chemistry. In the polymer industry, it acts as a sulfonamide additive for improving the properties of polymers. Additionally, it is utilized in sensors and semiconductors for its electrochemical and electronic properties.

About

CAS No 90824-33-2
English Name 2-Hydrazinobenzenesulfonamide
Molecular Formula C6H9N3O2S
Molecular Weight 187.22 g/mol
SMILES C1=CC=C(C(=C1)NN)S(=O)(=O)N
InChIKey CTEZEDIMFASQNI-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) is a crystalline compound with a molecular weight of...

Compound Q&A

How is 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) typically synthesized?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) can be synthesized through a multi-step process invo...

Compound Q&A

What precautions should be taken when handling 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

When handling 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...