Compound Q&A

What are the physical and chemical properties of 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

Answer

2-Hydrazinobenzenesulfonamide
2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) is a crystalline compound with a molecular weight of approximately 220.18 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. The compound is known for its reactivity towards nucleophiles and its ability to undergo substitution reactions. It has a melting point of around 140°C and is stable under normal conditions but should be handled in a fume hood to avoid inhalation exposure.

About

CAS No 90824-33-2
English Name 2-Hydrazinobenzenesulfonamide
Molecular Formula C6H9N3O2S
Molecular Weight 187.22 g/mol
SMILES C1=CC=C(C(=C1)NN)S(=O)(=O)N
InChIKey CTEZEDIMFASQNI-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) typically synthesized?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) can be synthesized through a multi-step process invo...

Compound Q&A

What industries use 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2) finds applications in various industries. It is used...

Compound Q&A

What precautions should be taken when handling 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2)?

When handling 2-Hydrazinobenzenesulfonamide (CAS: 90824-33-2), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...