Compound Q&A

What industries use Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

Answer

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate
Ethyl 2-(4-formyl-2-nitrophenoxy)acetate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It also finds applications in the polymer industry for the development of functional polymers, and in the sensor industry for the fabrication of gas sensors. The compound's unique chemical properties make it valuable in these fields.

About

English Name Ethyl 2-(4-formyl-2-nitrophenoxy)acetate
Molecular Formula C11H11NO6
Molecular Weight 253.21 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)C=O)[N+](=O)[O-]
InChIKey LJLACWKNDNQPQD-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4) typically synthesized?

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate can be synthesized by the condensation of 2-nitrophenol wit...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

When handling Ethyl 2-(4-formyl-2-nitrophenoxy)acetate, appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...