Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

Answer

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate
Ethyl 2-(4-formyl-2-nitrophenoxy)acetate is a crystalline compound with a molecular weight of approximately 282.07 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is reactive towards nucleophiles and oxidants, making it useful in organic synthesis. It exhibits weak acidity and can undergo electrophilic substitution reactions.

About

English Name Ethyl 2-(4-formyl-2-nitrophenoxy)acetate
Molecular Formula C11H11NO6
Molecular Weight 253.21 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)C=O)[N+](=O)[O-]
InChIKey LJLACWKNDNQPQD-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4) typically synthesized?

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate can be synthesized by the condensation of 2-nitrophenol wit...

Compound Q&A

What industries use Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

When handling Ethyl 2-(4-formyl-2-nitrophenoxy)acetate, appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...