Compound Q&A

How is Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4) typically synthesized?

Answer

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate
Ethyl 2-(4-formyl-2-nitrophenoxy)acetate can be synthesized by the condensation of 2-nitrophenol with ethyl acetoacetate in the presence of a catalyst, such as p-toluenesulfonic acid. The reaction is typically conducted under mild conditions, and the yield can be up to 70%. Selectivity towards the desired product is good, and the reaction is relatively straightforward.

About

English Name Ethyl 2-(4-formyl-2-nitrophenoxy)acetate
Molecular Formula C11H11NO6
Molecular Weight 253.21 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)C=O)[N+](=O)[O-]
InChIKey LJLACWKNDNQPQD-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

Ethyl 2-(4-formyl-2-nitrophenoxy)acetate is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-formyl-2-nitrophenoxy)acetate (CAS: 420786-61-4)?

When handling Ethyl 2-(4-formyl-2-nitrophenoxy)acetate, appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...