Compound Q&A

What industries use (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7)?

Answer

(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid
(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid is primarily used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of various drugs and also finds applications in the development of functional polymers. Additionally, it is used in the field of sensors for its unique boronic acid functionality.

About

English Name (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid
Molecular Formula C8H12BNO3
Molecular Weight 181 g/mol
SMILES B(C1=CN=C(C=C1)C(C)(C)O)(O)O
InChIKey UGEQHBKYUPTOPV-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7)?

(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid is a crystalline solid with a molecular weight of...

Compound Q&A

How is (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7) typically synthesized?

(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid can be synthesized using a multi-step process sta...

Compound Q&A

What precautions should be taken when handling (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7)?

When handling (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid, it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...