Compound Q&A

What are the physical and chemical properties of (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7)?

Answer

(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid
(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid is a crystalline solid with a molecular weight of approximately 279.25 g/mol. It has a solubility of about 0.001 g/100 mL in water. This compound is known for its reactivity in boron-containing reactions and its ability to act as a boronic acid derivative, which is common in Suzuki coupling reactions. It is also stable under normal laboratory conditions but may react with strong acids or bases.

About

English Name (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid
Molecular Formula C8H12BNO3
Molecular Weight 181 g/mol
SMILES B(C1=CN=C(C=C1)C(C)(C)O)(O)O
InChIKey UGEQHBKYUPTOPV-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7) typically synthesized?

(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid can be synthesized using a multi-step process sta...

Compound Q&A

What industries use (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7)?

(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid is primarily used in the pharmaceutical and polym...

Compound Q&A

What precautions should be taken when handling (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid (CAS: 1088496-42-7)?

When handling (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid, it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...