Compound Q&A

What precautions should be taken when handling 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

Answer

2-Chloro-3-(trifluoromethyl)benzoyl chloride
When handling 2-Chloro-3-(trifluoromethyl)benzoyl chloride, appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be worn. This compound should be handled in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up promptly using appropriate absorbents, and the area should be thoroughly washed down. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures.

About

English Name 2-Chloro-3-(trifluoromethyl)benzoyl chloride
Molecular Formula C8H3Cl2F3O
Molecular Weight 243.01 g/mol
SMILES ClC(=O)c1cccc(c1Cl)C(F)(F)F
InChIKey PKEMXTIVOBWBNO-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7) typically synthesized?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is typically synthesized by reacting trifluoromethylben...

Compound Q&A

What industries use 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is primarily used in the pharmaceutical industry for th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...