Compound Q&A

What industries use 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

Answer

2-Chloro-3-(trifluoromethyl)benzoyl chloride
2-Chloro-3-(trifluoromethyl)benzoyl chloride is primarily used in the pharmaceutical industry for the synthesis of medicinal compounds, as well as in the polymer industry for the production of specialty polymers. It also has applications in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 2-Chloro-3-(trifluoromethyl)benzoyl chloride
Molecular Formula C8H3Cl2F3O
Molecular Weight 243.01 g/mol
SMILES ClC(=O)c1cccc(c1Cl)C(F)(F)F
InChIKey PKEMXTIVOBWBNO-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7) typically synthesized?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is typically synthesized by reacting trifluoromethylben...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

When handling 2-Chloro-3-(trifluoromethyl)benzoyl chloride, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...