Compound Q&A

How is 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7) typically synthesized?

Answer

2-Chloro-3-(trifluoromethyl)benzoyl chloride
2-Chloro-3-(trifluoromethyl)benzoyl chloride is typically synthesized by reacting trifluoromethylbenzoic acid chloride with chlorine in the presence of a phase transfer catalyst. The reaction is exothermic and requires careful monitoring to prevent side reactions, ensuring a yield of up to 90%.

About

English Name 2-Chloro-3-(trifluoromethyl)benzoyl chloride
Molecular Formula C8H3Cl2F3O
Molecular Weight 243.01 g/mol
SMILES ClC(=O)c1cccc(c1Cl)C(F)(F)F
InChIKey PKEMXTIVOBWBNO-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

2-Chloro-3-(trifluoromethyl)benzoyl chloride is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-(trifluoromethyl)benzoyl chloride (CAS: 850156-39-7)?

When handling 2-Chloro-3-(trifluoromethyl)benzoyl chloride, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...