Compound Q&A

What precautions should be taken when handling Peptide M (CAS: 110652-62-5)?

Answer

Peptide M
When handling Peptide M (CAS: 110652-62-5), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name Peptide M
Molecular Formula C81H141N21O31
Molecular Weight 1905.1 g/mol
SMILES CCC(C)C(C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)NC(C(C)C)C(=O)O)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(C(C)CC)NC(=O)C(C(C)CC)NC(=O)C(C(C)O)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(C(C)O)NC(=O)C(CC(=O)O)N
InChIKey BHGSMPANCMIOOB-HMAOBDLHSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of Peptide M (CAS: 110652-62-5)?

Peptide M (CAS: 110652-62-5) is a crystalline compound with a molecular weight of approximately 1200...

Compound Q&A

How is Peptide M (CAS: 110652-62-5) typically synthesized?

Peptide M (CAS: 110652-62-5) is synthesized using solid-phase peptide synthesis (SPPS) techniques. T...

Compound Q&A

What industries use Peptide M (CAS: 110652-62-5)?

Peptide M (CAS: 110652-62-5) is widely used in the pharmaceutical and biotechnology industries for d...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA