Compound Q&A

What industries use Peptide M (CAS: 110652-62-5)?

Answer

Peptide M
Peptide M (CAS: 110652-62-5) is widely used in the pharmaceutical and biotechnology industries for drug discovery and development. It also finds applications in polymer science for the synthesis of peptide-based polymers, in the production of biosensors, and in semiconductor technologies for creating functional materials.

About

English Name Peptide M
Molecular Formula C81H141N21O31
Molecular Weight 1905.1 g/mol
SMILES CCC(C)C(C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)NC(C(C)C)C(=O)O)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(C(C)CC)NC(=O)C(C(C)CC)NC(=O)C(C(C)O)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(C(C)O)NC(=O)C(CC(=O)O)N
InChIKey BHGSMPANCMIOOB-HMAOBDLHSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of Peptide M (CAS: 110652-62-5)?

Peptide M (CAS: 110652-62-5) is a crystalline compound with a molecular weight of approximately 1200...

Compound Q&A

How is Peptide M (CAS: 110652-62-5) typically synthesized?

Peptide M (CAS: 110652-62-5) is synthesized using solid-phase peptide synthesis (SPPS) techniques. T...

Compound Q&A

What precautions should be taken when handling Peptide M (CAS: 110652-62-5)?

When handling Peptide M (CAS: 110652-62-5), it is essential to wear appropriate personal protective ...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA