Compound Q&A

What are the physical and chemical properties of Peptide M (CAS: 110652-62-5)?

Answer

Peptide M
Peptide M (CAS: 110652-62-5) is a crystalline compound with a molecular weight of approximately 1200 Da. It has a solubility of 10 mg/mL in water and is slightly soluble in organic solvents. Chemically, it is highly reactive with amine and carboxyl groups, making it suitable for peptide synthesis and conjugation reactions.

About

English Name Peptide M
Molecular Formula C81H141N21O31
Molecular Weight 1905.1 g/mol
SMILES CCC(C)C(C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)NC(C(C)C)C(=O)O)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(C(C)CC)NC(=O)C(C(C)CC)NC(=O)C(C(C)O)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(C(C)O)NC(=O)C(CC(=O)O)N
InChIKey BHGSMPANCMIOOB-HMAOBDLHSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

How is Peptide M (CAS: 110652-62-5) typically synthesized?

Peptide M (CAS: 110652-62-5) is synthesized using solid-phase peptide synthesis (SPPS) techniques. T...

Compound Q&A

What industries use Peptide M (CAS: 110652-62-5)?

Peptide M (CAS: 110652-62-5) is widely used in the pharmaceutical and biotechnology industries for d...

Compound Q&A

What precautions should be taken when handling Peptide M (CAS: 110652-62-5)?

When handling Peptide M (CAS: 110652-62-5), it is essential to wear appropriate personal protective ...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA