Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

Answer

BIBP3226 TFA
BIBP3226 TFA is synthesized via a multi-step process involving amino acid derivatization and TFA protection. Commonly, the synthesis involves protecting an amino group with TFA, followed by coupling with a desired linker or scaffold. The reaction proceeds with a high yield, typically above 90%, and uses common organic solvents and reagents.

About

English Name BIBP3226 TFA
Molecular Formula C29H32F3N5O5
Molecular Weight 587.590097427368 g/mol
SMILES FC(C(=O)O)(F)F.O=C(C(C1C=CC=CC=1)C1C=CC=CC=1)N[C@@H](C(NCC1C=CC(=CC=1)O)=O)CCC/N=C(\N)/N
InChIKey MTSZIDSCWZHKOD-GNAFDRTKSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of BIBP3226 TFA (CAS: 1068148-47-9)?

BIBP3226 TFA is a crystalline compound with a molecular weight of approximately 488.5 g/mol. It has ...

Compound Q&A

What industries use BIBP3226 TFA (CAS: 1068148-47-9)?

BIBP3226 TFA is primarily used in the pharmaceutical industry for its role as a research compound, p...

Compound Q&A

What precautions should be taken when handling BIBP3226 TFA (CAS: 1068148-47-9)?

When handling BIBP3226 TFA, it is crucial to wear appropriate personal protective equipment includin...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA