Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

Answer

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine
4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crystalline compound with a molecular weight of approximately 560.5 g/mol. It has a low solubility in water but is more soluble in organic solvents like DMSO and DMF. Chemically, it is highly stable but can react with strong acids or bases. Its reactivity is mainly due to the presence of pyridine rings, making it suitable for various coordination chemistry applications.

About

English Name 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine
Molecular Formula C22H16N4
Molecular Weight 336.398 g/mol
SMILES n1ccc(cc1)C(=C(c1ccncc1)c1ccncc1)c1ccncc1
InChIKey ZTIDKYAFTJKSNT-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) typically synthesized?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine is typically synthesized through the condensation...

Compound Q&A

What industries use 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

When handling 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0), it is crucial ...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA