Compound Q&A

What precautions should be taken when handling 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7)?

Answer

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride
When handling 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride, it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work in a well-ventilated area or under a fume hood to avoid inhalation or skin contact. In case of a spill, immediately clean it up using appropriate absorbent materials and follow the safety data sheet (SDS) guidelines for disposal. Proper training in chemical handling and emergency response is essential.

About

CAS No 52997-74-7
English Name 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride
Molecular Formula C9H11ClF3N
Molecular Weight 225.64 g/mol
SMILES C1=CC(=CC=C1CCN)C(F)(F)F.Cl
InChIKey MAPCNSROFGNSAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7)?

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride is a white crystalline solid. Its molecular we...

Compound Q&A

How is 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7) typically synthesized?

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride is typically synthesized through a multistep p...

Compound Q&A

What industries use 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7)?

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride is used in various industries, particularly in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...