Compound Q&A

What industries use 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7)?

Answer

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride
2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride is used in various industries, particularly in pharmaceuticals and fine chemicals. It serves as a precursor in the synthesis of medicinal compounds and is also utilized in the development of sensors and semiconductors due to its specific chemical properties.

About

CAS No 52997-74-7
English Name 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride
Molecular Formula C9H11ClF3N
Molecular Weight 225.64 g/mol
SMILES C1=CC(=CC=C1CCN)C(F)(F)F.Cl
InChIKey MAPCNSROFGNSAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7)?

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride is a white crystalline solid. Its molecular we...

Compound Q&A

How is 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7) typically synthesized?

2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride is typically synthesized through a multistep p...

Compound Q&A

What precautions should be taken when handling 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride (CAS: 52997-74-7)?

When handling 2-(4-Trifluoromethyl-phenyl)-ethylamine hydrochloride, it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...