Compound Q&A

What precautions should be taken when handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

Answer

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
When handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0), it is essential to wear appropriate personal protective equipment, including gloves, safety goggles, and a lab coat. This compound should be used in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be managed using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for specific handling procedures.

About

CAS No 2578-85-0
English Name 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
Molecular Formula C23H20N2O6
Molecular Weight 420.4 g/mol
SMILES C1=CC=C(C=C1)CC(C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3
InChIKey TVENQUPLPBPLGU-OAQYLSRUSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is a crystalline compound w...

Compound Q&A

How is 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) typically synthesized?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate is typically synthesized via a multistep pro...

Compound Q&A

What industries use 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is primarily used in pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...