Compound Q&A

How is 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) typically synthesized?

Answer

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate is typically synthesized via a multistep process involving the coupling of D-phenylalanine with 4-nitrophenyl chloroformate in the presence of a base like triethylamine. The reaction yields the desired product with good selectivity and moderate to high yield, depending on the reaction conditions.

About

CAS No 2578-85-0
English Name 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
Molecular Formula C23H20N2O6
Molecular Weight 420.4 g/mol
SMILES C1=CC=C(C=C1)CC(C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3
InChIKey TVENQUPLPBPLGU-OAQYLSRUSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is a crystalline compound w...

Compound Q&A

What industries use 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is primarily used in pharma...

Compound Q&A

What precautions should be taken when handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

When handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...