Compound Q&A

What are the physical and chemical properties of 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

Answer

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is a crystalline compound with a molecular weight of approximately 428.14 g/mol. It has a high solubility in organic solvents like methanol and ethanol. This compound exhibits moderate reactivity, particularly towards nucleophiles and reducing agents. It is often used in synthetic applications due to its stability under various conditions.

About

CAS No 2578-85-0
English Name 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
Molecular Formula C23H20N2O6
Molecular Weight 420.4 g/mol
SMILES C1=CC=C(C=C1)CC(C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3
InChIKey TVENQUPLPBPLGU-OAQYLSRUSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) typically synthesized?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate is typically synthesized via a multistep pro...

Compound Q&A

What industries use 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is primarily used in pharma...

Compound Q&A

What precautions should be taken when handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

When handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...