Compound Q&A

What industries use 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

Answer

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is primarily used in pharmaceuticals for intermediates in drug synthesis. It is also employed in the preparation of various polymers and in the development of chemical sensors. Its functional groups make it particularly useful in semiconductor applications for modifying surface properties.

About

CAS No 2578-85-0
English Name 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate
Molecular Formula C23H20N2O6
Molecular Weight 420.4 g/mol
SMILES C1=CC=C(C=C1)CC(C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3
InChIKey TVENQUPLPBPLGU-OAQYLSRUSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) is a crystalline compound w...

Compound Q&A

How is 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0) typically synthesized?

4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate is typically synthesized via a multistep pro...

Compound Q&A

What precautions should be taken when handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0)?

When handling 4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate (CAS: 2578-85-0), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...