Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

Answer

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
When handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate, it is essential to wear personal protective equipment (PPE) including gloves, goggles, and a lab coat. The substance should be used in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately with appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for specific handling and disposal instructions.

About

English Name 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES CC(C)(C)OC(=O)n1ccc2C(=O)CCCc21
InChIKey XRYXQDYFSBOZFJ-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is a crystalline solid with a m...

Compound Q&A

How is 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8) typically synthesized?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is typically synthesized throug...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is primarily used in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...