Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

Answer

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is a crystalline solid with a molecular weight of approximately 233.27 g/mol. It has a low water solubility and is slightly soluble in common organic solvents. This compound is reactive and can undergo various transformations under specific conditions. It is stable at room temperature but should be stored away from moisture and heat.

About

English Name 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES CC(C)(C)OC(=O)n1ccc2C(=O)CCCc21
InChIKey XRYXQDYFSBOZFJ-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8) typically synthesized?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is typically synthesized throug...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

When handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...