Compound Q&A

What industries use 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

Answer

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It also finds applications in the polymer industry for the development of functionalized polymers and in the semiconductor industry for use in organic light-emitting diodes (OLEDs).

About

English Name 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES CC(C)(C)OC(=O)n1ccc2C(=O)CCCc21
InChIKey XRYXQDYFSBOZFJ-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is a crystalline solid with a m...

Compound Q&A

How is 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8) typically synthesized?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

When handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...