Compound Q&A

How is 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8) typically synthesized?

Answer

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is typically synthesized through a multi-step process involving indole derivatization. A common approach involves the condensation of 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylic acid with 2-methyl-2-propanol in the presence of a suitable catalyst such as a Lewis acid. The reaction yields the desired compound with good selectivity and yield.

About

English Name 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES CC(C)(C)OC(=O)n1ccc2C(=O)CCCc21
InChIKey XRYXQDYFSBOZFJ-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is a crystalline solid with a m...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate (CAS: 877170-76-8)?

When handling 2-Methyl-2-propanyl 4-oxo-4,5,6,7-tetrahydro-1H-indole-1-carboxylate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...