Compound Q&A

What are the physical and chemical properties of 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8)?

Answer

4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide
4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8) is a white or off-white crystalline solid with a molecular weight of approximately 317.38 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. The compound is known for its stability and moderate reactivity, particularly in nucleophilic substitution reactions. It has a low melting point of around 130°C and is relatively non-toxic but requires proper handling due to its potential to cause skin and eye irritation.

About

CAS No 49701-24-8
English Name 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide
Molecular Formula C9H14N2O4S
Molecular Weight 246.29 g/mol
SMILES CNS(=O)(=O)C1=C(C=C(C(=C1)OC)N)OC
InChIKey CISVVDNATRQDNU-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8) typically synthesized?

4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8) is typically synthesized by the r...

Compound Q&A

What industries use 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8)?

4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8)?

When handling 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS: 49701-24-8), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...