Compound Q&A

What precautions should be taken when handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

Answer

5-[(4-Carboxybenzyl)oxy]isophthalic acid
When handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a well-ventilated area and away from heat sources to prevent degradation. Spills should be cleaned up immediately using appropriate absorbent materials. Laboratory safety data sheets (SDS) are available for reference and should be consulted for detailed handling and disposal guidelines.

About

English Name 5-[(4-Carboxybenzyl)oxy]isophthalic acid
Molecular Formula C16H12O7
Molecular Weight 316.27 g/mol
SMILES c1cc(ccc1COc2cc(cc(c2)C(=O)O)C(=O)O)C(=O)O
InChIKey GOZATJNCMKPSAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3) typically synthesized?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is synthesized through the condensation of 4-benzyloxyisoph...

Compound Q&A

What industries use 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is used in various industries. It is a key intermediate in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...