Compound Q&A

How is 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3) typically synthesized?

Answer

5-[(4-Carboxybenzyl)oxy]isophthalic acid
5-[(4-Carboxybenzyl)oxy]isophthalic acid is synthesized through the condensation of 4-benzyloxyisophthalic acid with carboxylic acid. This reaction is typically catalyzed by a strong acid such as sulfuric acid. The yield is usually around 85-90% with good selectivity. The process is carried out at elevated temperatures, and the product is purified by recrystallization from an appropriate solvent.

About

English Name 5-[(4-Carboxybenzyl)oxy]isophthalic acid
Molecular Formula C16H12O7
Molecular Weight 316.27 g/mol
SMILES c1cc(ccc1COc2cc(cc(c2)C(=O)O)C(=O)O)C(=O)O
InChIKey GOZATJNCMKPSAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is used in various industries. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

When handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...