Compound Q&A

What industries use 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

Answer

5-[(4-Carboxybenzyl)oxy]isophthalic acid
5-[(4-Carboxybenzyl)oxy]isophthalic acid is used in various industries. It is a key intermediate in the production of advanced polymers, particularly in the development of high-performance materials. It also finds applications in pharmaceuticals, where it is used in the synthesis of certain drugs. Additionally, it is utilized in the fabrication of sensors and in semiconductor manufacturing processes due to its unique chemical properties.

About

English Name 5-[(4-Carboxybenzyl)oxy]isophthalic acid
Molecular Formula C16H12O7
Molecular Weight 316.27 g/mol
SMILES c1cc(ccc1COc2cc(cc(c2)C(=O)O)C(=O)O)C(=O)O
InChIKey GOZATJNCMKPSAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3) typically synthesized?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is synthesized through the condensation of 4-benzyloxyisoph...

Compound Q&A

What precautions should be taken when handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

When handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...