Compound Q&A

What are the physical and chemical properties of 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

Answer

5-[(4-Carboxybenzyl)oxy]isophthalic acid
5-[(4-Carboxybenzyl)oxy]isophthalic acid is a crystalline compound with a molecular weight of approximately 318.19 g/mol. It has a pKa value of around 2.5, indicating acidic properties. The compound is sparingly soluble in water but soluble in organic solvents like methanol and ethanol. It exhibits moderate reactivity under acidic conditions and is susceptible to hydrolysis. It is stable in dry conditions but should be stored in a desiccator to prevent moisture absorption.

About

English Name 5-[(4-Carboxybenzyl)oxy]isophthalic acid
Molecular Formula C16H12O7
Molecular Weight 316.27 g/mol
SMILES c1cc(ccc1COc2cc(cc(c2)C(=O)O)C(=O)O)C(=O)O
InChIKey GOZATJNCMKPSAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3) typically synthesized?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is synthesized through the condensation of 4-benzyloxyisoph...

Compound Q&A

What industries use 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

5-[(4-Carboxybenzyl)oxy]isophthalic acid is used in various industries. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid (CAS: 1050912-62-3)?

When handling 5-[(4-Carboxybenzyl)oxy]isophthalic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...