Compound Q&A

What industries use Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

Answer

Sodium 3-formylbenzenesulfonate
Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) is used in the pharmaceutical industry for synthesis of certain drugs, in polymer chemistry for the modification of polymer properties, and in semiconductor manufacturing for etching processes. It also finds applications in dyeing and printing industries.

About

CAS No 5330-48-3
English Name Sodium 3-formylbenzenesulfonate
Molecular Formula C7H5NaO4S
Molecular Weight 209.1749 g/mol
SMILES c1cc(cc(c1)S(=O)(=O)[O-])C=O.[Na+]
InChIKey AFIUOLGCFDPAKN-UHFFFAOYSA-M
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) is a crystalline solid with a molecular weight of 2...

Compound Q&A

How is Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) typically synthesized?

Sodium 3-formylbenzenesulfonate is typically synthesized from 3-formylbenzenesulfonic acid through n...

Compound Q&A

What precautions should be taken when handling Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

When handling Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3), it is essential to use personal prot...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...