Compound Q&A

How is Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) typically synthesized?

Answer

Sodium 3-formylbenzenesulfonate
Sodium 3-formylbenzenesulfonate is typically synthesized from 3-formylbenzenesulfonic acid through neutralization with sodium hydroxide. The reaction is usually carried out in water, and the yield can be up to 85% with high selectivity. The process involves careful control of pH and temperature to optimize product formation.

About

CAS No 5330-48-3
English Name Sodium 3-formylbenzenesulfonate
Molecular Formula C7H5NaO4S
Molecular Weight 209.1749 g/mol
SMILES c1cc(cc(c1)S(=O)(=O)[O-])C=O.[Na+]
InChIKey AFIUOLGCFDPAKN-UHFFFAOYSA-M
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) is a crystalline solid with a molecular weight of 2...

Compound Q&A

What industries use Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) is used in the pharmaceutical industry for synthesi...

Compound Q&A

What precautions should be taken when handling Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

When handling Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3), it is essential to use personal prot...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...