Compound Q&A

What are the physical and chemical properties of Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

Answer

Sodium 3-formylbenzenesulfonate
Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) is a crystalline solid with a molecular weight of 216.22 g/mol. It has a high solubility in water and good solubility in organic solvents. This compound is moderately reactive, particularly towards nucleophilic substitution reactions. It is used in various applications due to its stability and reactivity.

About

CAS No 5330-48-3
English Name Sodium 3-formylbenzenesulfonate
Molecular Formula C7H5NaO4S
Molecular Weight 209.1749 g/mol
SMILES c1cc(cc(c1)S(=O)(=O)[O-])C=O.[Na+]
InChIKey AFIUOLGCFDPAKN-UHFFFAOYSA-M
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) typically synthesized?

Sodium 3-formylbenzenesulfonate is typically synthesized from 3-formylbenzenesulfonic acid through n...

Compound Q&A

What industries use Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3) is used in the pharmaceutical industry for synthesi...

Compound Q&A

What precautions should be taken when handling Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3)?

When handling Sodium 3-formylbenzenesulfonate (CAS: 5330-48-3), it is essential to use personal prot...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...