Compound Q&A

What precautions should be taken when handling tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5)?

Answer

tert-Butyl (3-amino-4-chlorophenyl)carbamate
When handling tert-Butyl (3-amino-4-chlorophenyl)carbamate, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or fume hood to prevent inhalation. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed guidelines on storage and disposal.

About

English Name tert-Butyl (3-amino-4-chlorophenyl)carbamate
Molecular Formula C11H15ClN2O2
Molecular Weight 242.71 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)N
InChIKey DBQDDWSYKOTBGD-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5)?

tert-Butyl (3-amino-4-chlorophenyl)carbamate is a white crystalline solid with a molecular weight o...

Compound Q&A

How is tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5) typically synthesized?

tert-Butyl (3-amino-4-chlorophenyl)carbamate is usually synthesized by the reaction of 3-chloro-4-(...

Compound Q&A

What industries use tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5)?

tert-Butyl (3-amino-4-chlorophenyl)carbamate is primarily used in the pharmaceutical industry for t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...