Compound Q&A

What are the physical and chemical properties of tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5)?

Answer

tert-Butyl (3-amino-4-chlorophenyl)carbamate
tert-Butyl (3-amino-4-chlorophenyl)carbamate is a white crystalline solid with a molecular weight of approximately 268.03 g/mol. It has limited water solubility but is more soluble in organic solvents like methanol and ethanol. The compound is known for its low reactivity under normal conditions but shows some tendency to hydrolyze in basic media. It exhibits good stability under neutral and acidic conditions.

About

English Name tert-Butyl (3-amino-4-chlorophenyl)carbamate
Molecular Formula C11H15ClN2O2
Molecular Weight 242.71 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)N
InChIKey DBQDDWSYKOTBGD-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5) typically synthesized?

tert-Butyl (3-amino-4-chlorophenyl)carbamate is usually synthesized by the reaction of 3-chloro-4-(...

Compound Q&A

What industries use tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5)?

tert-Butyl (3-amino-4-chlorophenyl)carbamate is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling tert-Butyl (3-amino-4-chlorophenyl)carbamate (CAS: 885270-73-5)?

When handling tert-Butyl (3-amino-4-chlorophenyl)carbamate, it is essential to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...