Compound Q&A

What precautions should be taken when handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

Answer

(5-Bromo-1,3-phenylene)bis(trimethylsilane)
When handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to fumes. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly rinsed. Always refer to the safety data sheet (SDS) for detailed handling and storage instructions.

About

CAS No 81500-92-7
English Name (5-Bromo-1,3-phenylene)bis(trimethylsilane)
Molecular Formula C12H21BrSi2
Molecular Weight 301.38 g/mol
SMILES BrC1=CC([Si](C)(C)C)=CC([Si](C)(C)C)=C1
InChIKey TZFLBWAKFGADPX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

The compound (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is a crystalline solid wi...

Compound Q&A

How is (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) typically synthesized?

(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is typically synthesized by the reacti...

Compound Q&A

What industries use (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is used in various industries, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...