Compound Q&A

What are the physical and chemical properties of (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

Answer

(5-Bromo-1,3-phenylene)bis(trimethylsilane)
The compound (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is a crystalline solid with a molecular weight of approximately 326.21 g/mol. It has low solubility in water but is soluble in organic solvents like toluene and dichloromethane. Chemically, it is stable under normal conditions but can react with strong bases to form bromide ions. It is often used in organic synthesis and as a precursor in polymer chemistry.

About

CAS No 81500-92-7
English Name (5-Bromo-1,3-phenylene)bis(trimethylsilane)
Molecular Formula C12H21BrSi2
Molecular Weight 301.38 g/mol
SMILES BrC1=CC([Si](C)(C)C)=CC([Si](C)(C)C)=C1
InChIKey TZFLBWAKFGADPX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) typically synthesized?

(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is typically synthesized by the reacti...

Compound Q&A

What industries use (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

When handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...