Compound Q&A

How is (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) typically synthesized?

Answer

(5-Bromo-1,3-phenylene)bis(trimethylsilane)
(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is typically synthesized by the reaction of 1,3-phenylenebis(trimethylsilyl) chloride with bromine in the presence of a base like dimethylaminopyridine. The reaction yields the brominated compound with high selectivity and good yield, making it a useful intermediate in various organic synthesis processes.

About

CAS No 81500-92-7
English Name (5-Bromo-1,3-phenylene)bis(trimethylsilane)
Molecular Formula C12H21BrSi2
Molecular Weight 301.38 g/mol
SMILES BrC1=CC([Si](C)(C)C)=CC([Si](C)(C)C)=C1
InChIKey TZFLBWAKFGADPX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

The compound (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is a crystalline solid wi...

Compound Q&A

What industries use (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

When handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...