Compound Q&A

What industries use (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

Answer

(5-Bromo-1,3-phenylene)bis(trimethylsilane)
(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is used in various industries, including pharmaceuticals for the synthesis of complex organic compounds, polymers for the modification of polymer properties, and sensors for detecting specific chemical species. It is also utilized in semiconductor manufacturing for surface functionalization and as a stabilizing agent.

About

CAS No 81500-92-7
English Name (5-Bromo-1,3-phenylene)bis(trimethylsilane)
Molecular Formula C12H21BrSi2
Molecular Weight 301.38 g/mol
SMILES BrC1=CC([Si](C)(C)C)=CC([Si](C)(C)C)=C1
InChIKey TZFLBWAKFGADPX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

The compound (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is a crystalline solid wi...

Compound Q&A

How is (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) typically synthesized?

(5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7) is typically synthesized by the reacti...

Compound Q&A

What precautions should be taken when handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7)?

When handling (5-Bromo-1,3-phenylene)bis(trimethylsilane) (CAS: 81500-92-7), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...