Compound Q&A

What industries use 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

Answer

5-Nitro-2-(trifluoromethyl)pyridine
5-Nitro-2-(trifluoromethyl)pyridine finds applications in the pharmaceutical industry for the synthesis of certain drugs, in the semiconductor industry for use in photoresists, and in the polymer industry for the development of advanced materials.

About

English Name 5-Nitro-2-(trifluoromethyl)pyridine
Molecular Formula C6H3F3N2O2
Molecular Weight 192.1 g/mol
SMILES C1=CC(=NC=C1[N+](=O)[O-])C(F)(F)F
InChIKey ZTSJYRKGWJZNON-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

5-Nitro-2-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7) typically synthesized?

5-Nitro-2-(trifluoromethyl)pyridine is typically synthesized via the nitration of 2-(trifluoromethyl...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

When handling 5-Nitro-2-(trifluoromethyl)pyridine, always wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...