Compound Q&A

How is 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7) typically synthesized?

Answer

5-Nitro-2-(trifluoromethyl)pyridine
5-Nitro-2-(trifluoromethyl)pyridine is typically synthesized via the nitration of 2-(trifluoromethyl)pyridine using a mixture of nitric acid and sulfuric acid as the oxidizing agent. The reaction is carried out under reflux to achieve high yield and selectivity.

About

English Name 5-Nitro-2-(trifluoromethyl)pyridine
Molecular Formula C6H3F3N2O2
Molecular Weight 192.1 g/mol
SMILES C1=CC(=NC=C1[N+](=O)[O-])C(F)(F)F
InChIKey ZTSJYRKGWJZNON-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

5-Nitro-2-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

5-Nitro-2-(trifluoromethyl)pyridine finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

When handling 5-Nitro-2-(trifluoromethyl)pyridine, always wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...