Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

Answer

5-Nitro-2-(trifluoromethyl)pyridine
5-Nitro-2-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of approximately 238.06 g/mol. It has limited water solubility and is moderately soluble in organic solvents like methanol and acetonitrile. Chemically, it is reactive, especially towards nucleophiles and reducing agents, and it can undergo nitration and reduction reactions.

About

English Name 5-Nitro-2-(trifluoromethyl)pyridine
Molecular Formula C6H3F3N2O2
Molecular Weight 192.1 g/mol
SMILES C1=CC(=NC=C1[N+](=O)[O-])C(F)(F)F
InChIKey ZTSJYRKGWJZNON-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7) typically synthesized?

5-Nitro-2-(trifluoromethyl)pyridine is typically synthesized via the nitration of 2-(trifluoromethyl...

Compound Q&A

What industries use 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

5-Nitro-2-(trifluoromethyl)pyridine finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-(trifluoromethyl)pyridine (CAS: 116470-66-7)?

When handling 5-Nitro-2-(trifluoromethyl)pyridine, always wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...