Compound Q&A

What precautions should be taken when handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Answer

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
When handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9), ensure use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be neutralized with an appropriate reagent and cleaned up promptly. Always refer to the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 89640-03-9
English Name Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Molecular Formula C7H6ClNO4S
Molecular Weight 235.64 g/mol
SMILES CCOC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-]
InChIKey VJKXMTCBMRGJIE-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) is a crystalline compound with a mol...

Compound Q&A

How is Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) typically synthesized?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is typically synthesized from 5-chloro-4-nitrothiophen...

Compound Q&A

What industries use Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is used in the pharmaceutical industry for the synthes...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...