Compound Q&A

How is Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) typically synthesized?

Answer

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is typically synthesized from 5-chloro-4-nitrothiophene and ethyl chloroformate using triethylamine as a base. The reaction is carried out in an organic solvent like dichloromethane under stirring and cooling. The yield is usually around 70-80%, and the product can be purified by recrystallization.

About

CAS No 89640-03-9
English Name Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Molecular Formula C7H6ClNO4S
Molecular Weight 235.64 g/mol
SMILES CCOC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-]
InChIKey VJKXMTCBMRGJIE-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) is a crystalline compound with a mol...

Compound Q&A

What industries use Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is used in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

When handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9), ensure use of persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...