Compound Q&A

What are the physical and chemical properties of Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Answer

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) is a crystalline compound with a molecular weight of approximately 250.03 g/mol. It has a low solubility in water but is moderately soluble in common organic solvents like ethanol and acetone. Chemically, it is reactive due to its thiophene and carboxylic acid functionalities, and it can undergo substitution and oxidation reactions easily.

About

CAS No 89640-03-9
English Name Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Molecular Formula C7H6ClNO4S
Molecular Weight 235.64 g/mol
SMILES CCOC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-]
InChIKey VJKXMTCBMRGJIE-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) typically synthesized?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is typically synthesized from 5-chloro-4-nitrothiophen...

Compound Q&A

What industries use Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is used in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

When handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9), ensure use of persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...