Compound Q&A

What industries use Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Answer

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is used in the pharmaceutical industry for the synthesis of certain drugs, as well as in the development of sensors and electronic materials. Its reactivity and functional groups make it valuable for applications in polymer chemistry and semiconductor technology.

About

CAS No 89640-03-9
English Name Ethyl 5-chloro-4-nitrothiophene-2-carboxylate
Molecular Formula C7H6ClNO4S
Molecular Weight 235.64 g/mol
SMILES CCOC(=O)C1=CC(=C(S1)Cl)[N+](=O)[O-]
InChIKey VJKXMTCBMRGJIE-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) is a crystalline compound with a mol...

Compound Q&A

How is Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9) typically synthesized?

Ethyl 5-chloro-4-nitrothiophene-2-carboxylate is typically synthesized from 5-chloro-4-nitrothiophen...

Compound Q&A

What precautions should be taken when handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9)?

When handling Ethyl 5-chloro-4-nitrothiophene-2-carboxylate (CAS: 89640-03-9), ensure use of persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...